|
CAS#: 4701-10-4 Product: 1-Nitro-4-Phenylbutadiene No suppilers available for the product. |
| Name | 1-Nitro-4-Phenylbutadiene |
|---|---|
| Synonyms | 1-Nitro-4-Phenyl-1,3-Butadiene; 1-Nitro-4-Phenylbutadiene; Benzene, (4-Nitro-1,3-Butadienyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 |
| CAS Registry Number | 4701-10-4 |
| SMILES | C1=C(\C=C\C=C\[N+]([O-])=O)C=CC=C1 |
| InChI | 1S/C10H9NO2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H/b8-4+,9-5+ |
| InChIKey | HXAORLISYKTFNQ-KBXRYBNXSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.815°C at 760 mmHg (Cal.) |
| Flash point | 150.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-4-Phenylbutadiene |