|
CAS#: 4707-77-1 Product: 4,5-Dihydroxyisophthalic Acid No suppilers available for the product. |
| Name | 4,5-Dihydroxyisophthalic Acid |
|---|---|
| Synonyms | 4,5-Dihydroxyisophthalic Acid; 1,3-Benzenedicarboxylic Acid, 4,5-Dihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 4707-77-1 |
| SMILES | C1=C(C=C(C(=C1C(O)=O)O)O)C(O)=O |
| InChI | 1S/C8H6O6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | FBOCZYIJDQZQFE-UHFFFAOYSA-N |
| Density | 1.779g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.125°C at 760 mmHg (Cal.) |
| Flash point | 284.86°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dihydroxyisophthalic Acid |