|
CAS#: 4714-30-1 Product: 1-Chloro-4-(1,2,2,2-Tetrachloroethyl)Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-(1,2,2,2-Tetrachloroethyl)Benzene |
|---|---|
| Synonyms | 1-(P-Chlorophenyl)-1,2,2,2-Tetrachloroethane; 3-05-00-00794 (Beilstein Handbook Reference); Brn 1957057 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl5 |
| Molecular Weight | 278.39 |
| CAS Registry Number | 4714-30-1 |
| SMILES | C1=CC(=CC=C1Cl)C(C(Cl)(Cl)Cl)Cl |
| InChI | 1S/C8H5Cl5/c9-6-3-1-5(2-4-6)7(10)8(11,12)13/h1-4,7H |
| InChIKey | AKZMYVMRQFGDOS-UHFFFAOYSA-N |
| Density | 1.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.951°C at 760 mmHg (Cal.) |
| Flash point | 140.439°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-(1,2,2,2-Tetrachloroethyl)Benzene |