|
CAS#: 472-57-1 Product: 16 beta,17 beta-Epoxy-1,3,5(10)-Estratrien-3-Ol No suppilers available for the product. |
| Name | 16 beta,17 beta-Epoxy-1,3,5(10)-Estratrien-3-Ol |
|---|---|
| Synonyms | 16,17-Est; 16Alpha,17Alpha-Epoxyestra-1,3,5-Trien-3-Ol; 16Beta,17Beta-Epoxy-1,3,5(10)-Estratrien-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 472-57-1 |
| SMILES | [C@@H]12O[C@H]1C[C@@H]4[C@@]2(CC[C@@H]5C3=CC=C(O)C=C3CC[C@@H]45)C |
| InChI | 1S/C18H22O2/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16-17(18)20-16/h3,5,8,13-17,19H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | XPXOJYZDBJGFEI-LMMHAMTPSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.916°C at 760 mmHg (Cal.) |
| Flash point | 198.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16 beta,17 beta-Epoxy-1,3,5(10)-Estratrien-3-Ol |