|
CAS#: 472-96-8 Product: 1-Methyl-1,2,3,4,5,6-cyclohexanehexol No suppilers available for the product. |
| Name | 1-Methyl-1,2,3,4,5,6-cyclohexanehexol |
|---|---|
| Synonyms | Inositol, 4-C-Methyl-, Myo-; Myo-Inositol, 4-C-Methyl-; 2-C-Methyl-Myo-Inositol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 |
| CAS Registry Number | 472-96-8 |
| SMILES | CC1(O)C(O)C(O)C(O)C(O)C1O |
| InChI | 1S/C7H14O6/c1-7(13)5(11)3(9)2(8)4(10)6(7)12/h2-6,8-13H,1H3 |
| InChIKey | AJGYLNFUYLRZFR-UHFFFAOYSA-N |
| Density | 1.818g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.369°C at 760 mmHg (Cal.) |
| Flash point | 137.582°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-1,2,3,4,5,6-cyclohexanehexol |