| Name | (1R,3S)-2,2-Dimethyl-1,3-Cyclobutanedicarboxylic Acid |
|---|---|
| Synonyms | norpinic acid (cis) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 473-69-8 |
| SMILES | CC1([C@H](C[C@H]1C(=O)O)C(=O)O)C |
| InChI | 1S/C8H12O4/c1-8(2)4(6(9)10)3-5(8)7(11)12/h4-5H,3H2,1-2H3,(H,9,10)(H,11,12)/t4-,5+ |
| InChIKey | KLGKVMMWRDYKJM-SYDPRGILSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.0±15.0°C at 760 mmHg (Cal.) |
| Flash point | 121.7±16.9°C (Cal.) |
| (1) | Yan Ma, Andrew T. Russell and George Marston. Mechanisms for the formation of secondary organic aerosol components from the gas-phase ozonolysis of α-pinene, Phys. Chem. Chem. Phys., 2008, 10, 4294. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,3S)-2,2-Dimethyl-1,3-Cyclobutanedicarboxylic Acid |