|
CAS#: 473-99-4 Product: Eburnamine No suppilers available for the product. |
| Name | Eburnamine |
|---|---|
| Synonyms | Eburnamenin-14-Ol, 14,15-Dihydro-, (14Alpha)-; Eburnamine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 |
| CAS Registry Number | 473-99-4 |
| SMILES | [C@H]2([N]4C1=C(CCN3[C@@H]1[C@@](C2)(CCC3)CC)C5=C4C=CC=C5)O |
| InChI | 1S/C19H24N2O/c1-2-19-9-5-10-20-11-8-14-13-6-3-4-7-15(13)21(16(22)12-19)17(14)18(19)20/h3-4,6-7,16,18,22H,2,5,8-12H2,1H3/t16-,18-,19+/m0/s1 |
| InChIKey | HONLKDDLTAZVQV-YTQUADARSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.43°C at 760 mmHg (Cal.) |
| Flash point | 246.775°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Eburnamine |