|
CAS#: 4733-52-2 Product: Phthaloyl Peroxide No suppilers available for the product. |
| Name | Phthaloyl Peroxide |
|---|---|
| Synonyms | 2,3-Benzodioxine-1,4-Quinone; 2,3-Benzodioxin-1,4-Dione; Phthalic Peroxide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4O4 |
| Molecular Weight | 164.12 |
| CAS Registry Number | 4733-52-2 |
| SMILES | C1=C2C(=CC=C1)C(OOC2=O)=O |
| InChI | 1S/C8H4O4/c9-7-5-3-1-2-4-6(5)8(10)12-11-7/h1-4H |
| InChIKey | WMKGMCCZGTXXQU-UHFFFAOYSA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.055°C at 760 mmHg (Cal.) |
| Flash point | 123.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phthaloyl Peroxide |