Online Database of Chemicals from Around the World
|
CAS#: 4755-89-9 Product: 1-(3-Ethyl-5,5,6,8,8-Pentamethyl-Tetralin-2-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(3-Ethyl-5,5,6,8,8-Pentamethyl-Tetralin-2-Yl)Ethanone |
|---|---|
| Synonyms | 1-(7-Ethyl-1,1,2,4,4-Pentamethyl-Tetralin-6-Yl)Ethanone; 1-(7-Ethyl-1,1,2,4,4-Pentamethyl-6-Tetralinyl)Ethanone; Nsc17430 |
| Molecular Structure |  |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 |
| CAS Registry Number | 4755-89-9 |
| SMILES | C1=C(C(=CC2=C1C(C(C)CC2(C)C)(C)C)C(C)=O)CC |
| InChI | 1S/C19H28O/c1-8-14-9-17-16(10-15(14)13(3)20)18(4,5)11-12(2)19(17,6)7/h9-10,12H,8,11H2,1-7H3 |
| InChIKey | LMPKSOXFUSKMGB-UHFFFAOYSA-N |
| Density | 0.916g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.997°C at 760 mmHg (Cal.) |
| Flash point | 156.109°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Ethyl-5,5,6,8,8-Pentamethyl-Tetralin-2-Yl)Ethanone |