|
CAS#: 477-17-8 Product: Hippeastrine No suppilers available for the product. |
| Name | Hippeastrine |
|---|---|
| Synonyms | C08528; Hippeastrine; Prestwick3_000675 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 |
| CAS Registry Number | 477-17-8 |
| SMILES | [C@@H]34C2=CC1=C(OCO1)C=C2C(O[C@@H]3[C@H](C=C5[C@H]4N(CC5)C)O)=O |
| InChI | 1S/C17H17NO5/c1-18-3-2-8-4-11(19)16-14(15(8)18)9-5-12-13(22-7-21-12)6-10(9)17(20)23-16/h4-6,11,14-16,19H,2-3,7H2,1H3/t11-,14-,15+,16+/m0/s1 |
| InChIKey | DGQPIOQRPAGNGB-DANNLKNASA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.251°C at 760 mmHg (Cal.) |
| Flash point | 279.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hippeastrine |