Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Flusalan |
|---|---|
| Synonyms | Fluorosalan (Usan); 3,5-Dibromo-.Alpha.,.Alpha.,.Alpha.-Trifluoro-M-Salicylotoluidide; Aids-127479 |
| Molecular Structure |  |
| Molecular Formula | C14H8Br2F3NO2 |
| Molecular Weight | 439.03 |
| CAS Registry Number | 4776-06-1 |
| EINECS | 225-322-0 |
| SMILES | C1=C(Br)C=C(C(=C1C(NC2=CC(=CC=C2)C(F)(F)F)=O)O)Br |
| InChI | 1S/C14H8Br2F3NO2/c15-8-5-10(12(21)11(16)6-8)13(22)20-9-3-1-2-7(4-9)14(17,18)19/h1-6,21H,(H,20,22) |
| InChIKey | VYKKDKFTDMVOBU-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 178.4±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Flusalan |