|
CAS#: 479-05-0 Product: Flaviolin No suppilers available for the product. |
| Name | Flaviolin |
|---|---|
| Synonyms | 4,5,7-Trihydroxy-1,2-Naphthoquinone; 1,4-Naphthalenedione, 2,5,7-Trihydroxy-; 2,5,7-Trihydroxynaphthoquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O5 |
| Molecular Weight | 206.15 |
| CAS Registry Number | 479-05-0 |
| SMILES | C1=C(O)C=C(O)C2=C1C(=O)C(=O)C=C2O |
| InChI | 1S/C10H6O5/c11-4-1-5-9(6(12)2-4)7(13)3-8(14)10(5)15/h1-3,11-13H |
| InChIKey | XNPCAGMCQDGQKK-UHFFFAOYSA-N |
| Density | 1.802g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.39°C at 760 mmHg (Cal.) |
| Flash point | 294.081°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Flaviolin |