Online Database of Chemicals from Around the World
| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (978) 521-6300 | |||
 |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Name | [3-(Propionyloxy)Phenyl]Boronic Acid |
|---|---|
| Synonyms | 3-(2-Carboxyethyl)phenylboronic acid; 3-(3-Boronophenyl)propionic acid; 3-Ethoxycarbonylphenylboronic acid |
| Molecular Structure | ![CAS#: 480424-85-9, [3-(Propionyloxy)Phenyl]Boronic Acid](/moreStructures/480424-85-9.gif) |
| Molecular Formula | C9H11BO4 |
| Molecular Weight | 193.99 |
| CAS Registry Number | 480424-85-9 |
| SMILES | B(C1=CC(=CC=C1)OC(=O)CC)(O)O |
| InChI | 1S/C9H11BO4/c1-2-9(11)14-8-5-3-4-7(6-8)10(12)13/h3-6,12-13H,2H2,1H3 |
| InChIKey | HFTSZRNVEIDPTE-UHFFFAOYSA-N |
| Density | 1.11-1.31 (Expl.) |
|---|---|
| 1.2±0.1g/cm3 (Cal.) | |
| Melting point | 135-139°C (Expl.) |
| Boiling point | 367.3±44.0°C at 760 mmHg (Cal.) |
| Flash point | 175.9±28.4°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol |  X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| Market Analysis Reports |
| List of Reports Available for [3-(Propionyloxy)Phenyl]Boronic Acid |