|
CAS#: 48077-86-7 Product: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Methacrylate No suppilers available for the product. |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Ester; 2-Methylacrylic Acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Ester; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Methacrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H7F21O2 |
| Molecular Weight | 618.19 |
| CAS Registry Number | 48077-86-7 |
| EINECS | 256-354-3 |
| SMILES | C(OC(=O)C(=C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C15H7F21O2/c1-4(2)5(37)38-3-6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)13(30,31)14(32,33)15(34,35)36/h1,3H2,2H3 |
| InChIKey | QDIWIWGKFGVURE-UHFFFAOYSA-N |
| Density | 1.588g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.232°C at 760 mmHg (Cal.) |
| Flash point | 111.96°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecyl Methacrylate |