|
CAS#: 48141-64-6 Product: [R-(R*,S*)]-alpha-[1-(Ethylmethylamino)Ethyl]Benzyl Alcohol No suppilers available for the product. |
| Name | [R-(R*,S*)]-alpha-[1-(Ethylmethylamino)Ethyl]Benzyl Alcohol |
|---|---|
| Synonyms | (1R,2S)-2-(Ethyl-Methyl-Amino)-1-Phenyl-Propan-1-Ol; (R-(R*,S*))-Alpha-(1-(Ethylmethylamino)Ethyl)Benzyl Alcohol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 |
| CAS Registry Number | 48141-64-6 |
| EINECS | 256-359-0 |
| SMILES | [C@@H](O)(C1=CC=CC=C1)[C@@H](N(CC)C)C |
| InChI | 1S/C12H19NO/c1-4-13(3)10(2)12(14)11-8-6-5-7-9-11/h5-10,12,14H,4H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | IRVLBORJKFZWMI-JQWIXIFHSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.844°C at 760 mmHg (Cal.) |
| Flash point | 104.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [R-(R*,S*)]-alpha-[1-(Ethylmethylamino)Ethyl]Benzyl Alcohol |