|
CAS#: 4845-14-1 Product: N-Methyl-N-[4-(Phenylazo)Phenyl]Formamide No suppilers available for the product. |
| Name | N-Methyl-N-[4-(Phenylazo)Phenyl]Formamide |
|---|---|
| Synonyms | N-Methyl-N-(4-Phenylazophenyl)Formamide; N-Methyl-N-(4-Phenyldiazenylphenyl)Methanamide; 4-Formylmonomethylaminoazobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 |
| CAS Registry Number | 4845-14-1 |
| SMILES | C1=C(N(C=O)C)C=CC(=C1)N=NC2=CC=CC=C2 |
| InChI | 1S/C14H13N3O/c1-17(11-18)14-9-7-13(8-10-14)16-15-12-5-3-2-4-6-12/h2-11H,1H3 |
| InChIKey | PUPBFFGOAGWILX-UHFFFAOYSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.927°C at 760 mmHg (Cal.) |
| Flash point | 215.022°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-N-[4-(Phenylazo)Phenyl]Formamide |