| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 2-Isopropylidene-5,5-Dimethyl-1,3-Dioxane-4,6-Dione |
|---|---|
| Synonyms | 5,5-Dimethyl-2-(1-methylethylidene)-1,3-dioxane-4,6-dione #; 5,5-dimethyl-2-(methylethylidene)-1,3-dioxane-4,6-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 4858-67-7 |
| SMILES | O=C1OC(\OC(=O)C1(C)C)=C(/C)C |
| InChI | 1S/C9H12O4/c1-5(2)6-12-7(10)9(3,4)8(11)13-6/h1-4H3 |
| InChIKey | MZVHGCGCZPYDGJ-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.473°C at 760 mmHg (Cal.) |
| Flash point | 167.927°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropylidene-5,5-Dimethyl-1,3-Dioxane-4,6-Dione |