|
CAS#: 4868-12-6 Product: 4-Isopropylidene-2,2,3,3-Tetramethylcyclobutanone No suppilers available for the product. |
| Name | 4-Isopropylidene-2,2,3,3-Tetramethylcyclobutanone |
|---|---|
| Synonyms | 2,2,3,3-Tetramethyl-4-(1-methylethylidene)cyclobutanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 4868-12-6 |
| SMILES | O=C1/C(=C(/C)C)C(C)(C)C1(C)C |
| InChI | 1S/C11H18O/c1-7(2)8-9(12)11(5,6)10(8,3)4/h1-6H3 |
| InChIKey | RCVKTPCLHTZCTC-UHFFFAOYSA-N |
| Density | 0.893g/cm3 (Cal.) |
|---|---|
| Boiling point | 212.568°C at 760 mmHg (Cal.) |
| Flash point | 90.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Isopropylidene-2,2,3,3-Tetramethylcyclobutanone |