|
CAS#: 488-05-1 Product: Elsholtziaketone No suppilers available for the product. |
| Name | Elsholtziaketone |
|---|---|
| Synonyms | 3-Methyl-1-(3-Methyl-2-Furyl)Butan-1-One; 1-Butanone, 3-Methyl-1-(3-Methyl-2-Furanyl)-; Elsholtziaketone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| CAS Registry Number | 488-05-1 |
| SMILES | C1=CC(=C(O1)C(CC(C)C)=O)C |
| InChI | 1S/C10H14O2/c1-7(2)6-9(11)10-8(3)4-5-12-10/h4-5,7H,6H2,1-3H3 |
| InChIKey | MYPGRLGQLDFZMK-UHFFFAOYSA-N |
| Density | 0.978g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.783°C at 760 mmHg (Cal.) |
| Flash point | 102.757°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Elsholtziaketone |