Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-(3,4-Dihydroxyphenyl)-3,4-Dihydro-(2R,3S)-2H-1-Benzopyran-3,7-Diol |
|---|---|
| Synonyms | Kbio2_004758; Kbio2_007326; Bspbio_001913 |
| Molecular Structure |  |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 |
| CAS Registry Number | 490-49-3 |
| SMILES | [C@@H]1(OC2=C(C[C@@H]1O)C=CC(=C2)O)C3=CC(=C(C=C3)O)O |
| InChI | 1S/C15H14O5/c16-10-3-1-8-5-13(19)15(20-14(8)7-10)9-2-4-11(17)12(18)6-9/h1-4,6-7,13,15-19H,5H2/t13-,15+/m0/s1 |
| InChIKey | VFZYLYJWCROVLO-DZGCQCFKSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.202°C at 760 mmHg (Cal.) |
| Flash point | 297.438°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dihydroxyphenyl)-3,4-Dihydro-(2R,3S)-2H-1-Benzopyran-3,7-Diol |