|
CAS#: 4900-73-6 Product: 6-Methyl-7H-Benzocyclohepten-7-One No suppilers available for the product. |
| Name | 6-Methyl-7H-Benzocyclohepten-7-One |
|---|---|
| Synonyms | 8-Methyl-7-Benzo[7]Annulenone; Zinc03847099; 7H-Benzocyclohepten-7-One,6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 |
| CAS Registry Number | 4900-73-6 |
| SMILES | C1=CC=CC2=C1C=C(C(=O)C=C2)C |
| InChI | 1S/C12H10O/c1-9-8-11-5-3-2-4-10(11)6-7-12(9)13/h2-8H,1H3 |
| InChIKey | DVPSDPRLPHEFDN-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.873°C at 760 mmHg (Cal.) |
| Flash point | 141.481°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-7H-Benzocyclohepten-7-One |