|
CAS#: 491-48-5 Product: 5,7-Dihydroxy-2,6-Dimethyl-4H-Chromen-4-One No suppilers available for the product. |
| Name | 5,7-Dihydroxy-2,6-Dimethyl-4H-Chromen-4-One |
|---|---|
| Synonyms | EUGENITOL; DivK1c_006127 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19 |
| CAS Registry Number | 491-48-5 |
| SMILES | O=C\1c2c(O)c(c(O)cc2O/C(=C/1)C)C |
| InChI | 1S/C11H10O4/c1-5-3-8(13)10-9(15-5)4-7(12)6(2)11(10)14/h3-4,12,14H,1-2H3 |
| InChIKey | HMAUJNAGOIPKDG-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.138°C at 760 mmHg (Cal.) |
| Flash point | 167.441°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dihydroxy-2,6-Dimethyl-4H-Chromen-4-One |