| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2,4'-Diaminobiphenyl |
|---|---|
| Synonyms | [2-(4-Aminophenyl)Phenyl]Amine; O,P'-Dianiline; Ortho,Para'-Bianiline |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 |
| CAS Registry Number | 492-17-1 |
| SMILES | C1=CC(=CC=C1N)C2=C(C=CC=C2)N |
| InChI | 1S/C12H12N2/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h1-8H,13-14H2 |
| InChIKey | RDMFEHLCCOQUMH-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.998°C at 760 mmHg (Cal.) |
| Flash point | 201.2±20.4°C (Cal.) |
| (1) | Shinichi Yamabe, Hazuki Nakata and Shoko Yamazaki. π Complexes in benzidine rearrangement, Org. Biomol. Chem., 2009, 7, 4631. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4'-Diaminobiphenyl |