|
CAS#: 492-46-6 Product: 3,4-Dihydroxyphenylserine No suppilers available for the product. |
| Name | 3,4-Dihydroxyphenylserine |
|---|---|
| Synonyms | (2S)-2-Amino-3-(3,4-Dihydroxyphenyl)-3-Hydroxy-Propanoic Acid; (2S)-2-Amino-3-(3,4-Dihydroxyphenyl)-3-Hydroxy-Propionic Acid; Dihydroxyphenylserine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 492-46-6 |
| SMILES | [C@H](N)(C(O)C1=CC(=C(O)C=C1)O)C(=O)O |
| InChI | 1S/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8?/m0/s1 |
| InChIKey | QXWYKJLNLSIPIN-JAMMHHFISA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.773°C at 760 mmHg (Cal.) |
| Flash point | 286.293°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydroxyphenylserine |