Online Database of Chemicals from Around the World
|
CAS#: 494-23-5 Product: (2S,5R)-5-(3-Furyl)-2-(2-Oxo-4-Methylpentyl)-2-Methyltetrahydrofuran No suppilers available for the product. |
| Name | (2S,5R)-5-(3-Furyl)-2-(2-Oxo-4-Methylpentyl)-2-Methyltetrahydrofuran |
|---|---|
| Synonyms | 1-[5-(3-Furyl)-2-Methyl-Tetrahydrofuran-2-Yl]-4-Methyl-Pentan-2-One; 1-[5-(3-Furyl)-2-Methyl-2-Tetrahydrofuranyl]-4-Methylpentan-2-One; 1-(5-Furan-3-Yl-2-Methyl-Oxolan-2-Yl)-4-Methyl-Pentan-2-One |
| Molecular Structure |  |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 494-23-5 (20007-82-3) |
| SMILES | C2=C(C1OC(CC(=O)CC(C)C)(C)CC1)C=CO2 |
| InChI | 1S/C15H22O3/c1-11(2)8-13(16)9-15(3)6-4-14(18-15)12-5-7-17-10-12/h5,7,10-11,14H,4,6,8-9H2,1-3H3 |
| InChIKey | WOFDWNOSFDVCDF-UHFFFAOYSA-N |
| Density | 1.017g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.634°C at 760 mmHg (Cal.) |
| Flash point | 161.624°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,5R)-5-(3-Furyl)-2-(2-Oxo-4-Methylpentyl)-2-Methyltetrahydrofuran |