|
CAS#: 4951-97-7 Product: 1-(3-Ethyl-2,2-Dimethylcyclobutyl)Ethanone No suppilers available for the product. |
| Name | 1-(3-Ethyl-2,2-Dimethylcyclobutyl)Ethanone |
|---|---|
| Synonyms | 1-[(1R,3S)-3-Ethyl-2,2-Dimethyl-Cyclobutyl]Ethanone; Cyclobutane, 1-Acetyl-2,2-Dimethyl-3-Ethyl-, (Cis)-; Ketone, 3-Ethyl-2,2-Dimethylcyclobutyl Methyl (Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 4951-97-7 |
| SMILES | [C@@H]1(C([C@H](C1)CC)(C)C)C(C)=O |
| InChI | 1S/C10H18O/c1-5-8-6-9(7(2)11)10(8,3)4/h8-9H,5-6H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | XNOFWVNVNSRMKB-IUCAKERBSA-N |
| Density | 0.866g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.953°C at 760 mmHg (Cal.) |
| Flash point | 79.355°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Ethyl-2,2-Dimethylcyclobutyl)Ethanone |