|
CAS#: 49561-95-7 Product: 6-Ethyl-5-[4-(Trifluoromethoxy)Phenyl]-2,4-Pyrimidinediamine No suppilers available for the product. |
| Name | 6-Ethyl-5-[4-(Trifluoromethoxy)Phenyl]-2,4-Pyrimidinediamine |
|---|---|
| Synonyms | [2-Amino-6-Ethyl-5-[4-(Trifluoromethoxy)Phenyl]Pyrimidin-4-Yl]Amine; 5-25-13-00205 (Beilstein Handbook Reference); Brn 0690177 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 |
| CAS Registry Number | 49561-95-7 |
| SMILES | C2=C(C1=C(N=C(N=C1N)N)CC)C=CC(=C2)OC(F)(F)F |
| InChI | 1S/C13H13F3N4O/c1-2-9-10(11(17)20-12(18)19-9)7-3-5-8(6-4-7)21-13(14,15)16/h3-6H,2H2,1H3,(H4,17,18,19,20) |
| InChIKey | MEJWUWIYHWPDMH-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.1°C at 760 mmHg (Cal.) |
| Flash point | 227.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethyl-5-[4-(Trifluoromethoxy)Phenyl]-2,4-Pyrimidinediamine |