|
CAS#: 49583-27-9 Product: 3-Methyl-1-(2,4,6-Trihydroxy-3-Methylphenyl)-1-Butanone No suppilers available for the product. |
| Name | 3-Methyl-1-(2,4,6-Trihydroxy-3-Methylphenyl)-1-Butanone |
|---|---|
| Synonyms | 3-Methyl-1-(2,4,6-trihydroxy-3-methylphenyl)-1-butanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25 |
| CAS Registry Number | 49583-27-9 |
| SMILES | O=C(c1c(O)cc(O)c(c1O)C)CC(C)C |
| InChI | 1S/C12H16O4/c1-6(2)4-9(14)11-10(15)5-8(13)7(3)12(11)16/h5-6,13,15-16H,4H2,1-3H3 |
| InChIKey | AQGJJVVGIDQMHX-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.599°C at 760 mmHg (Cal.) |
| Flash point | 186.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1-(2,4,6-Trihydroxy-3-Methylphenyl)-1-Butanone |