Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Amino-3-Cyanobenzenesulfonamide |
|---|---|
| Synonyms | 4-amino-3-cyanobenzenesulfonamide |
| Molecular Structure |  |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.21 |
| CAS Registry Number | 49674-12-6 |
| SMILES | c1cc(c(cc1S(=O)(=O)N)C#N)N |
| InChI | 1S/C7H7N3O2S/c8-4-5-3-6(13(10,11)12)1-2-7(5)9/h1-3H,9H2,(H2,10,11,12) |
| InChIKey | BTISBCKRPUVXKE-UHFFFAOYSA-N |
| Density | 1.553g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.514°C at 760 mmHg (Cal.) |
| Flash point | 236.544°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-3-Cyanobenzenesulfonamide |