|
CAS#: 49676-83-7 Product: Cobalt Bis(3,5,5-Trimethylhexanoate) No suppilers available for the product. |
| Name | Cobalt Bis(3,5,5-Trimethylhexanoate) |
|---|---|
| Synonyms | Cobaltous 3,5,5-Trimethylhexanoate; 3,5,5-Trimethylhexanoic Acid, Cobalt Salt; Cobalt Bis(3,5,5-Trimethylhexanoate) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H34CoO4 |
| Molecular Weight | 373.40 |
| CAS Registry Number | 49676-83-7 |
| EINECS | 256-426-4 |
| SMILES | C(C(C)(C)C)C(CC([O-])=O)C.C(C(C)(C)C)C(CC([O-])=O)C.[Co++] |
| InChI | 1S/2C9H18O2.Co/c2*1-7(5-8(10)11)6-9(2,3)4;/h2*7H,5-6H2,1-4H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | CQQXUVXKYNCVQK-UHFFFAOYSA-L |
| Boiling point | 243.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cobalt Bis(3,5,5-Trimethylhexanoate) |