|
CAS#: 49707-37-1 Product: Trenbolone Acetate No suppilers available for the product. |
| Name | Trenbolone Acetate |
|---|---|
| Synonyms | Acetic Acid [(8S,13S,14S)-13-Methyl-3-Oxo-2,6,7,8,14,15,16,17-Octahydro-1H-Cyclopenta[A]Phenanthren-17-Yl] Ester; Acetic Acid [(8S,13S,14S)-3-Keto-13-Methyl-2,6,7,8,14,15,16,17-Octahydro-1H-Cyclopenta[A]Phenanthren-17-Yl] Ester; [(8S,13S,14S)-13-Methyl-3-Oxo-2,6,7,8,14,15,16,17-Octahydro-1H-Cyclopenta[A]Phenanthren-17-Yl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 |
| CAS Registry Number | 49707-37-1 |
| SMILES | [C@H]13[C@@](C(OC(C)=O)CC1)(C=CC4=C2C(=CC(=O)CC2)CC[C@@H]34)C |
| InChI | 1S/C20H24O3/c1-12(21)23-19-8-7-18-17-5-3-13-11-14(22)4-6-15(13)16(17)9-10-20(18,19)2/h9-11,17-19H,3-8H2,1-2H3/t17-,18+,19?,20+/m1/s1 |
| InChIKey | CMRJPMODSSEAPL-FBUBALKHSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.737°C at 760 mmHg (Cal.) |
| Flash point | 214.706°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trenbolone Acetate |