| Name | Bis(2-Ethylhexyl) Hydrogen Phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H35O4P |
| Molecular Weight | 322.42 |
| CAS Registry Number | 4971-46-4 |
| EINECS | 225-614-8 |
| SMILES | CCCCC(CC)COP(=O)(O)OCC(CC)CCCC |
| InChI | 1S/C16H35O4P/c1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3,(H,17,18) |
| InChIKey | SEGLCEQVOFDUPX-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 20 (Expl.) | |
| Boiling point | 393.4±25.0°C at 760 mmHg (Cal.) |
| Flash point | 191.7±23.2°C (Cal.) |
| Refractive index | 1.443 (Expl.) |
| Safety Description | WARNING: Irritates skin and eyes |
|---|---|
| IRRITANT | |
| CAUTION: May irritate eyes, skin, and respiratory tract | |
| (1) | Katherine D. Weaver, Hye Jin Kim, Jiazeng Sun, Douglas R. MacFarlane and Gloria D. Elliott. Cyto-toxicity and biocompatibility of a family of choline phosphate ionic liquids designed for pharmaceutical applications, Green Chem., 2010, 12, 507. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bis(2-Ethylhexyl) Hydrogen Phosphate |