|
CAS#: 49808-20-0 Product: 6,6-Dithiobispurine No suppilers available for the product. |
| Name | 6,6-Dithiobispurine |
|---|---|
| Synonyms | Aids-071897; Aids071897; Purin-6-Yl Purin-6-Yl Disulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6N8S2 |
| Molecular Weight | 302.33 |
| CAS Registry Number | 49808-20-0 |
| SMILES | C2=NC1=C([NH]C=N1)C(=N2)SSC3=NC=NC4=C3[NH]C=N4 |
| InChI | 1S/C10H6N8S2/c1-11-5-7(13-1)15-3-17-9(5)19-20-10-6-8(14-2-12-6)16-4-18-10/h1-4H,(H,11,13,15,17)(H,12,14,16,18) |
| InChIKey | ULNKLXSTZWVSJH-UHFFFAOYSA-N |
| Density | 1.861g/cm3 (Cal.) |
|---|---|
| Boiling point | 787.534°C at 760 mmHg (Cal.) |
| Flash point | 430.085°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6-Dithiobispurine |