Online Database of Chemicals from Around the World
|
CAS#: 49830-89-9 Product: 6-Methoxy-4-Phenyl-1-(2,2,2-Trifluoroethyl)-2-(1H)-Quinazolinone No suppilers available for the product. |
| Name | 6-Methoxy-4-Phenyl-1-(2,2,2-Trifluoroethyl)-2-(1H)-Quinazolinone |
|---|---|
| Synonyms | 6-Methoxy-4-Phenyl-1-(2,2,2-Trifluoroethyl)-2-Quinazolinone; 2(1H)-Quinazolinone, 6-Methoxy-4-Phenyl-1-(2,2,2-Trifluoroethyl)-; 6-Methoxy-4-Phenyl-1-(2,2,2-Trifluoroethyl)-2(1H)-Quinazolinone |
| Molecular Structure |  |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 |
| CAS Registry Number | 49830-89-9 |
| SMILES | C1=C2C(=CC=C1OC)N(C(=O)N=C2C3=CC=CC=C3)CC(F)(F)F |
| InChI | 1S/C17H13F3N2O2/c1-24-12-7-8-14-13(9-12)15(11-5-3-2-4-6-11)21-16(23)22(14)10-17(18,19)20/h2-9H,10H2,1H3 |
| InChIKey | MZGQIBQVSJDWHM-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.579°C at 760 mmHg (Cal.) |
| Flash point | 216.021°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-4-Phenyl-1-(2,2,2-Trifluoroethyl)-2-(1H)-Quinazolinone |