Online Database of Chemicals from Around the World
| Name | 6-(Bromomethyl)Benzo[b]Pyrene |
|---|---|
| Synonyms | 6-Bromomethylbenzo(A)Pyrene; Benzo(A)Pyrene, 6-Bromomethyl-; Brn 2468290 |
| Molecular Structure | ![CAS#: 49852-85-9, 6-(Bromomethyl)Benzo[b]Pyrene](/moreStructures/49852-85-9.gif) |
| Molecular Formula | C21H13Br |
| Molecular Weight | 345.24 |
| CAS Registry Number | 49852-85-9 |
| SMILES | C1=CC4=C3C2=C1C5=C(C(=C2C=CC3=CC=C4)CBr)C=CC=C5 |
| InChI | 1S/C21H13Br/c22-12-19-16-7-2-1-6-15(16)17-10-8-13-4-3-5-14-9-11-18(19)21(17)20(13)14/h1-11H,12H2 |
| InChIKey | DMAOOKLAQXNHTK-UHFFFAOYSA-N |
| Density | 1.53g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.978°C at 760 mmHg (Cal.) |
| Flash point | 268.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Bromomethyl)Benzo[b]Pyrene |
