Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Triamcinolone Furetonide |
|---|---|
| Synonyms | Tiamcinoloni Furetonidum [Inn-Latin]; Triamcinolona Furetonido [Inn-Spanish] |
| Molecular Structure |  |
| Molecular Formula | C33H35FO8 |
| Molecular Weight | 578.63 |
| CAS Registry Number | 4989-94-0 |
| EINECS | 225-650-4 |
| SMILES | [C@@]45([C@@]3([C@H]([C@H]2[C@]([C@@]1(C(=CC(=O)C=C1)CC2)C)(F)[C@H](C3)O)C[C@H]4OC(O5)(C)C)C)C(COC(C6=CC7=C(O6)C=CC=C7)=O)=O |
| InChI | 1S/C33H35FO8/c1-29(2)41-27-15-22-21-10-9-19-14-20(35)11-12-30(19,3)32(21,34)25(36)16-31(22,4)33(27,42-29)26(37)17-39-28(38)24-13-18-7-5-6-8-23(18)40-24/h5-8,11-14,21-22,25,27,36H,9-10,15-17H2,1-4H3/t21-,22-,25-,27+,30-,31-,32-,33+/m0/s1 |
| InChIKey | OSWKQSQWSQSPQH-GNFRAIDCSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 708.855°C at 760 mmHg (Cal.) |
| Flash point | 382.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triamcinolone Furetonide |