|
CAS#: 4997-62-0 Product: 1,1',2,2',3,3'-Hexaphenyl-1,1'-Bi(2-Cyclopropene) No suppilers available for the product. |
| Name | 1,1',2,2',3,3'-Hexaphenyl-1,1'-Bi(2-Cyclopropene) |
|---|---|
| Synonyms | Benzene, 1,1',1'',1''',1'''',1'''''-[Bi-2-Cyclopropen-1-Yl]-1,1',2,2',3,3'-Hexaylhexakis-; Cyclopropene,Bis-3,3'-Triphenyl-; Benzene, 1,1',1'',1''',1'''',1'''''-(Bi-2-Cyclopropen-1-Yl)-1,1',2,2',3,3'-Hexaylhexakis- |
| Molecular Structure | ![]() |
| Molecular Formula | C42H30 |
| Molecular Weight | 534.70 |
| CAS Registry Number | 4997-62-0 |
| SMILES | C8=C(C1=C(C1(C2(C(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7)C=CC=C8 |
| InChI | 1S/C42H30/c1-7-19-31(20-8-1)37-38(32-21-9-2-10-22-32)41(37,35-27-15-5-16-28-35)42(36-29-17-6-18-30-36)39(33-23-11-3-12-24-33)40(42)34-25-13-4-14-26-34/h1-30H |
| InChIKey | DQELQSOUCKXCIO-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.563°C at 760 mmHg (Cal.) |
| Flash point | 310.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1',2,2',3,3'-Hexaphenyl-1,1'-Bi(2-Cyclopropene) |