Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Methoxy[1,2,4]Triazolo[1,5-a][1,3,5]Triazine-7(1H)-Thione |
|---|---|
| Synonyms | 5-methoxy-[1,2,4]triazolo[1,5-a][1,3,5]triazine-7(1H)-thione; NSC171781 |
| Molecular Structure | ![CAS#: 500892-61-5, 5-Methoxy[1,2,4]Triazolo[1,5-a][1,3,5]Triazine-7(1H)-Thione](/moreStructures/500892-61-5.gif) |
| Molecular Formula | C5H5N5OS |
| Molecular Weight | 183.19 |
| CAS Registry Number | 500892-61-5 |
| SMILES | S=C2/N=C(\N=C1\N=C/NN12)OC |
| InChI | 1S/C5H5N5OS/c1-11-4-8-3-6-2-7-10(3)5(12)9-4/h2H,1H3,(H,6,7,8,9,12) |
| InChIKey | NIUDCAMRGGMSCE-UHFFFAOYSA-N |
| Density | 1.833g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.506°C at 760 mmHg (Cal.) |
| Flash point | 94.417°C (Cal.) |
| Refractive index | 1.865 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy[1,2,4]Triazolo[1,5-a][1,3,5]Triazine-7(1H)-Thione |