|
CAS#: 5014-47-1 Product: N-Chlorobenzanilide No suppilers available for the product. |
| Name | N-Chlorobenzanilide |
|---|---|
| Synonyms | N-Chloro-N-Phenyl-Benzamide; Nsc83719; Benzamide, N-Chloro-N-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.68 |
| CAS Registry Number | 5014-47-1 |
| SMILES | C1=CC=CC=C1C(N(Cl)C2=CC=CC=C2)=O |
| InChI | 1S/C13H10ClNO/c14-15(12-9-5-2-6-10-12)13(16)11-7-3-1-4-8-11/h1-10H |
| InChIKey | CJMAMOWDLBJBKI-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.102°C at 760 mmHg (Cal.) |
| Flash point | 158.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Chlorobenzanilide |