|
CAS#: 5019-61-4 Product: 1-[3-(5-Nitro-2-Furyl)-1H-1,2,4-Triazol-1-Yl]Ethanone No suppilers available for the product. |
| Name | 1-[3-(5-Nitro-2-Furyl)-1H-1,2,4-Triazol-1-Yl]Ethanone |
|---|---|
| Synonyms | 1-(3-(5-Nitrofuran-2-yl)-1H-1,2,4-triazol-1-yl)ethanone; 1-Acetyl-3-(5-nitro-2-furyl)-1H-1,2,4-triazole # |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6N4O4 |
| Molecular Weight | 222.16 |
| CAS Registry Number | 5019-61-4 |
| SMILES | O=[N+]([O-])c2oc(c1nn(C(=O)C)cn1)cc2 |
| InChI | 1S/C8H6N4O4/c1-5(13)11-4-9-8(10-11)6-2-3-7(16-6)12(14)15/h2-4H,1H3 |
| InChIKey | FCMWZURFINDRRP-UHFFFAOYSA-N |
| Density | 1.672g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.162°C at 760 mmHg (Cal.) |
| Flash point | 218.188°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(5-Nitro-2-Furyl)-1H-1,2,4-Triazol-1-Yl]Ethanone |