|
CAS#: 5025-38-7 Product: 9,10-Diethyl-3,6-Dimethoxyphenanthrene No suppilers available for the product. |
| Name | 9,10-Diethyl-3,6-Dimethoxyphenanthrene |
|---|---|
| Synonyms | 9,10-Diethyl-3,6-dimethoxyphenanthrene # |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 |
| CAS Registry Number | 5025-38-7 |
| SMILES | O(c3ccc2c(c(c1ccc(OC)cc1c2c3)CC)CC)C |
| InChI | 1S/C20H22O2/c1-5-15-16(6-2)18-10-8-14(22-4)12-20(18)19-11-13(21-3)7-9-17(15)19/h7-12H,5-6H2,1-4H3 |
| InChIKey | WQZWCZYHRLYWAC-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.042°C at 760 mmHg (Cal.) |
| Flash point | 176.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Diethyl-3,6-Dimethoxyphenanthrene |