|
CAS#: 50275-57-5 Product: 3-(1-Hydroxyethyl)-3-Phenyl-2,6-Piperidinedione No suppilers available for the product. |
| Name | 3-(1-Hydroxyethyl)-3-Phenyl-2,6-Piperidinedione |
|---|---|
| Synonyms | 2-(1-Hydroxyethyl)-2-phenylglutarimide; 2,6-Piperidinedione, 3-(1-hydroxyethyl)-3-phenyl-; 3-(1-Hydroxyethyl)-3-phenyl-2,6-piperidinedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.26 |
| CAS Registry Number | 50275-57-5 |
| SMILES | O=C1NC(=O)CCC1(c2ccccc2)C(O)C |
| InChI | 1S/C13H15NO3/c1-9(15)13(10-5-3-2-4-6-10)8-7-11(16)14-12(13)17/h2-6,9,15H,7-8H2,1H3,(H,14,16,17) |
| InChIKey | XHMCNOHNFNMYFS-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.182°C at 760 mmHg (Cal.) |
| Flash point | 225.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Hydroxyethyl)-3-Phenyl-2,6-Piperidinedione |