|
CAS#: 50299-98-4 Product: 3-O-Tert-Butyllevorphanol No suppilers available for the product. |
| Name | 3-O-Tert-Butyllevorphanol |
|---|---|
| Synonyms | 3-Tert-Butoxy-N-Methylmorphinan; Morphinan, 3-(1,1-Dimethylethoxy)-17-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 |
| CAS Registry Number | 50299-98-4 |
| SMILES | [C@@]234C1=C(C=CC(=C1)OC(C)(C)C)C[C@H]([C@@H]2CCCC3)N(CC4)C |
| InChI | 1S/C21H31NO/c1-20(2,3)23-16-9-8-15-13-19-17-7-5-6-10-21(17,18(15)14-16)11-12-22(19)4/h8-9,14,17,19H,5-7,10-13H2,1-4H3/t17-,19+,21+/m0/s1 |
| InChIKey | HWTLPRHSBYNYIX-FBBABVLZSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.238°C at 760 mmHg (Cal.) |
| Flash point | 124.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-O-Tert-Butyllevorphanol |