|
CAS#: 50326-38-0 Product: 1,1'-[Sulphonylbis(p-Phenyleneoxy)]Dipropan-2-Ol No suppilers available for the product. |
| Name | 1,1'-[Sulphonylbis(p-Phenyleneoxy)]Dipropan-2-Ol |
|---|---|
| Synonyms | 1,1'-(Sulphonylbis(P-Phenyleneoxy))Dipropan-2-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.43 |
| CAS Registry Number | 50326-38-0 |
| EINECS | 256-544-6 |
| SMILES | C2=C([S](C1=CC=C(OCC(O)C)C=C1)(=O)=O)C=CC(=C2)OCC(O)C |
| InChI | 1S/C18H22O6S/c1-13(19)11-23-15-3-7-17(8-4-15)25(21,22)18-9-5-16(6-10-18)24-12-14(2)20/h3-10,13-14,19-20H,11-12H2,1-2H3 |
| InChIKey | ZTUNUWXWAKQYMN-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.402°C at 760 mmHg (Cal.) |
| Flash point | 305.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[Sulphonylbis(p-Phenyleneoxy)]Dipropan-2-Ol |