|
CAS#: 50332-16-6 Product: 5,6,7,8-Tetrahydro-5-(p-Toluoyl)Cyclopenta[b]-1,3-Dioxolo[4,5-f]Indole No suppilers available for the product. |
| Name | 5,6,7,8-Tetrahydro-5-(p-Toluoyl)Cyclopenta[b]-1,3-Dioxolo[4,5-f]Indole |
|---|---|
| Synonyms | Cyclopenta(B)-1,3-Dioxolo(4,5-F)Indole, 5,6,7,8-Tetrahydro-5-(4-Methylbenzoyl)-; Cyclopenta(B)-1,3-Dioxolo(4,5-F)Indole, 5,6,7,8-Tetrahydro-5-(P-Toluoyl)-; 5-(P-Toluoyl)-5,6,7,8-Tetrahydrocyclopenta(B)-1,3-Dioxolo(4,5-F)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 |
| CAS Registry Number | 50332-16-6 |
| SMILES | C1=C5C(=CC2=C1C4=C([N]2C(C3=CC=C(C=C3)C)=O)CCC4)OCO5 |
| InChI | 1S/C20H17NO3/c1-12-5-7-13(8-6-12)20(22)21-16-4-2-3-14(16)15-9-18-19(10-17(15)21)24-11-23-18/h5-10H,2-4,11H2,1H3 |
| InChIKey | NENOBKWTSGGIIR-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.162°C at 760 mmHg (Cal.) |
| Flash point | 220.607°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8-Tetrahydro-5-(p-Toluoyl)Cyclopenta[b]-1,3-Dioxolo[4,5-f]Indole |