|
CAS#: 50337-85-4 Product: 4,4-Bis(4-Fluorophenyl)Butan-1-Ol No suppilers available for the product. |
| Name | 4,4-Bis(4-Fluorophenyl)Butan-1-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 |
| CAS Registry Number | 50337-85-4 |
| EINECS | 256-550-9 |
| SMILES | C1=C(F)C=CC(=C1)C(C2=CC=C(F)C=C2)CCCO |
| InChI | 1S/C16H16F2O/c17-14-7-3-12(4-8-14)16(2-1-11-19)13-5-9-15(18)10-6-13/h3-10,16,19H,1-2,11H2 |
| InChIKey | BMPMPXFWCYAFJO-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.215°C at 760 mmHg (Cal.) |
| Flash point | 182.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Bis(4-Fluorophenyl)Butan-1-Ol |