Online Database of Chemicals from Around the World
| Name | 1-(2,4,6-Trichlorophenyl)-3,3-Dimethyltriazene |
|---|---|
| Synonyms | N-Methyl-N-(2,4,6-Trichlorophenyl)Azo-Methanamine; N-Methyl-N-(2,4,6-Trichlorophenyl)Azomethanamine; Dimethyl-(2,4,6-Trichlorophenyl)Azo-Amine |
| Molecular Structure |  |
| Molecular Formula | C8H8Cl3N3 |
| Molecular Weight | 252.53 |
| CAS Registry Number | 50355-74-3 |
| SMILES | C1=C(Cl)C=C(C(=C1Cl)N=NN(C)C)Cl |
| InChI | 1S/C8H8Cl3N3/c1-14(2)13-12-8-6(10)3-5(9)4-7(8)11/h3-4H,1-2H3 |
| InChIKey | MMCIMUJXJHNNAU-UHFFFAOYSA-N |
| Density | 1.409g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.824°C at 760 mmHg (Cal.) |
| Flash point | 151.458°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4,6-Trichlorophenyl)-3,3-Dimethyltriazene |
