|
CAS#: 5038-48-2 Product: 2,3-Dichloro-1,4-Diphenyl-Butane-1,4-Dione No suppilers available for the product. |
| Name | 2,3-Dichloro-1,4-Diphenyl-Butane-1,4-Dione |
|---|---|
| Synonyms | Nsc54899 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12Cl2O2 |
| Molecular Weight | 307.18 |
| CAS Registry Number | 5038-48-2 |
| SMILES | C1=CC=CC=C1C(=O)C(Cl)C(Cl)C(C2=CC=CC=C2)=O |
| InChI | 1S/C16H12Cl2O2/c17-13(15(19)11-7-3-1-4-8-11)14(18)16(20)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | GRZPRSBXKCWANP-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.818°C at 760 mmHg (Cal.) |
| Flash point | 194.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dichloro-1,4-Diphenyl-Butane-1,4-Dione |