Online Database of Chemicals from Around the World
| Name | 4-Amidinophenyl benzoate |
|---|---|
| Synonyms | 4-Carbamimidoylbenzoic Acid Phenyl Ester; 4-Amidinobenzoic Acid Phenyl Ester; 4-Amidinophenylbenzoate |
| Molecular Structure |  |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 50466-20-1 |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=CC=C2)C(=N)N |
| InChI | 1S/C14H12N2O2/c15-13(16)10-6-8-11(9-7-10)14(17)18-12-4-2-1-3-5-12/h1-9H,(H3,15,16) |
| InChIKey | IGTONLPXDLZDKC-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.775°C at 760 mmHg (Cal.) |
| Flash point | 199.81°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amidinophenyl benzoate |
