|
CAS#: 50537-08-1 Product: Ethyl 2-(3-Chloro-4-Nitrophenyl)Propanoate No suppilers available for the product. |
| Name | Ethyl 2-(3-Chloro-4-Nitrophenyl)Propanoate |
|---|---|
| Synonyms | 2-(3-Chloro-4-nitro-phenyl)-propionic acid ethyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 |
| CAS Registry Number | 50537-08-1 |
| SMILES | O=[N+]([O-])c1ccc(cc1Cl)C(C)C(=O)OCC |
| InChI | 1S/C11H12ClNO4/c1-3-17-11(14)7(2)8-4-5-10(13(15)16)9(12)6-8/h4-7H,3H2,1-2H3 |
| InChIKey | ZQYLPVMDRALBFI-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.28°C at 760 mmHg (Cal.) |
| Flash point | 162.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(3-Chloro-4-Nitrophenyl)Propanoate |